C15H22N4S — CID 144872027
3-amino-5-[2-(methylamino)-1,3-thiazol-5-yl]benzonitrile;ethane (PubChem CID 144872027) has the molecular formula C15H22N4S and a molecular weight of 290.44 g/mol. Its IUPAC name is 3-amino-5-[2-(methylamino)-1,3-thiazol-5-yl]benzonitrile;ethane.
| Compound Name | 3-amino-5-[2-(methylamino)-1,3-thiazol-5-yl]benzonitrile;ethane |
|---|---|
| PubChem CID | 144872027 |
| Molecular Formula | C15H22N4S |
| Molecular Weight | 290.44 g/mol |
| Exact Mass | 290.16 |
| IUPAC Name | 3-amino-5-[2-(methylamino)-1,3-thiazol-5-yl]benzonitrile;ethane |
| SMILES | CC.CC.CNc1ncc(-c2cc(N)cc(C#N)c2)s1 |
| InChI | InChI=1S/C11H10N4S.2C2H6/c1-14-11-15-6-10(16-11)8-2-7(5-12)3-9(13)4-8;2*1-2/h2-4,6H,13H2,1H3,(H,14,15);2*1-2H3 |
| InChIKey | OCHSICRAQGOMPA-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 74.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.44 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|