C23H18F2N6O2 — CID 144872142
5-[2,4-difluoro-3-(6-phenyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)phenyl]-2,4-dimethyl-1,3-oxazole;formamide (PubChem CID 144872142) has the molecular formula C23H18F2N6O2 and a molecular weight of 448.43 g/mol. Its IUPAC name is 5-[2,4-difluoro-3-(6-phenyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)phenyl]-2,4-dimethyl-1,3-oxazole;formamide.
| Compound Name | 5-[2,4-difluoro-3-(6-phenyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)phenyl]-2,4-dimethyl-1,3-oxazole;formamide |
|---|---|
| PubChem CID | 144872142 |
| Molecular Formula | C23H18F2N6O2 |
| Molecular Weight | 448.43 g/mol |
| Exact Mass | 448.15 |
| IUPAC Name | 5-[2,4-difluoro-3-(6-phenyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)phenyl]-2,4-dimethyl-1,3-oxazole;formamide |
| SMILES | Cc1nc(C)c(-c2ccc(F)c(-c3nc4ncc(-c5ccccc5)cn4n3)c2F)o1.NC=O |
| InChI | InChI=1S/C22H15F2N5O.CH3NO/c1-12-20(30-13(2)26-12)16-8-9-17(23)18(19(16)24)21-27-22-25-10-15(11-29(22)28-21)14-6-4-3-5-7-14;2-1-3/h3-11H,1-2H3;1H,(H2,2,3) |
| InChIKey | WOEIOXIOXKANDM-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 112.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.43 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|