C15H20N4O4S — CID 144873253
4-(3-ethoxy-1-ethylpyrazol-4-yl)sulfonyl-2,3-dihydro-1,4-benzoxazin-6-amine (PubChem CID 144873253) has the molecular formula C15H20N4O4S and a molecular weight of 352.42 g/mol. Its IUPAC name is 4-(3-ethoxy-1-ethylpyrazol-4-yl)sulfonyl-2,3-dihydro-1,4-benzoxazin-6-amine.
| Compound Name | 4-(3-ethoxy-1-ethylpyrazol-4-yl)sulfonyl-2,3-dihydro-1,4-benzoxazin-6-amine |
|---|---|
| PubChem CID | 144873253 |
| Molecular Formula | C15H20N4O4S |
| Molecular Weight | 352.42 g/mol |
| Exact Mass | 352.12 |
| IUPAC Name | 4-(3-ethoxy-1-ethylpyrazol-4-yl)sulfonyl-2,3-dihydro-1,4-benzoxazin-6-amine |
| SMILES | CCOc1nn(CC)cc1S(=O)(=O)N1CCOc2ccc(N)cc21 |
| InChI | InChI=1S/C15H20N4O4S/c1-3-18-10-14(15(17-18)22-4-2)24(20,21)19-7-8-23-13-6-5-11(16)9-12(13)19/h5-6,9-10H,3-4,7-8,16H2,1-2H3 |
| InChIKey | ZZMGFPBKVVSYDP-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 99.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.42 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|