C14H15ClN4O4S — CID 144873395
N-[4-(3-chloro-1-ethylpyrazol-4-yl)sulfonyl-2,3-dihydro-1,4-benzoxazin-6-yl]formamide (PubChem CID 144873395) has the molecular formula C14H15ClN4O4S and a molecular weight of 370.82 g/mol. Its IUPAC name is N-[4-(3-chloro-1-ethylpyrazol-4-yl)sulfonyl-2,3-dihydro-1,4-benzoxazin-6-yl]formamide.
| Compound Name | N-[4-(3-chloro-1-ethylpyrazol-4-yl)sulfonyl-2,3-dihydro-1,4-benzoxazin-6-yl]formamide |
|---|---|
| PubChem CID | 144873395 |
| Molecular Formula | C14H15ClN4O4S |
| Molecular Weight | 370.82 g/mol |
| Exact Mass | 370.05 |
| IUPAC Name | N-[4-(3-chloro-1-ethylpyrazol-4-yl)sulfonyl-2,3-dihydro-1,4-benzoxazin-6-yl]formamide |
| SMILES | CCn1cc(S(=O)(=O)N2CCOc3ccc(NC=O)cc32)c(Cl)n1 |
| InChI | InChI=1S/C14H15ClN4O4S/c1-2-18-8-13(14(15)17-18)24(21,22)19-5-6-23-12-4-3-10(16-9-20)7-11(12)19/h3-4,7-9H,2,5-6H2,1H3,(H,16,20) |
| InChIKey | MXCVFWGWBKHANR-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 93.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.82 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|