C13H15ClN4O3S — CID 144873299
4-(3-chloro-1-ethylpyrazol-4-yl)sulfonyl-2,3-dihydro-1,4-benzoxazin-6-amine (PubChem CID 144873299) has the molecular formula C13H15ClN4O3S and a molecular weight of 342.81 g/mol. Its IUPAC name is 4-(3-chloro-1-ethylpyrazol-4-yl)sulfonyl-2,3-dihydro-1,4-benzoxazin-6-amine.
| Compound Name | 4-(3-chloro-1-ethylpyrazol-4-yl)sulfonyl-2,3-dihydro-1,4-benzoxazin-6-amine |
|---|---|
| PubChem CID | 144873299 |
| Molecular Formula | C13H15ClN4O3S |
| Molecular Weight | 342.81 g/mol |
| Exact Mass | 342.06 |
| IUPAC Name | 4-(3-chloro-1-ethylpyrazol-4-yl)sulfonyl-2,3-dihydro-1,4-benzoxazin-6-amine |
| SMILES | CCn1cc(S(=O)(=O)N2CCOc3ccc(N)cc32)c(Cl)n1 |
| InChI | InChI=1S/C13H15ClN4O3S/c1-2-17-8-12(13(14)16-17)22(19,20)18-5-6-21-11-4-3-9(15)7-10(11)18/h3-4,7-8H,2,5-6,15H2,1H3 |
| InChIKey | OUCMSSPSVSRPDO-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 90.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.81 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|