C9H13N2NaO2 — CID 144874588
sodium;4,6-dimethylpyrimidine-5-carboxylate;ethane (PubChem CID 144874588) has the molecular formula C9H13N2NaO2 and a molecular weight of 204.20 g/mol. Its IUPAC name is sodium;4,6-dimethylpyrimidine-5-carboxylate;ethane.
| Compound Name | sodium;4,6-dimethylpyrimidine-5-carboxylate;ethane |
|---|---|
| PubChem CID | 144874588 |
| Molecular Formula | C9H13N2NaO2 |
| Molecular Weight | 204.20 g/mol |
| Exact Mass | 204.09 |
| IUPAC Name | sodium;4,6-dimethylpyrimidine-5-carboxylate;ethane |
| SMILES | CC.Cc1ncnc(C)c1C(=O)[O-].[Na+] |
| InChI | InChI=1S/C7H8N2O2.C2H6.Na/c1-4-6(7(10)11)5(2)9-3-8-4;1-2;/h3H,1-2H3,(H,10,11);1-2H3;/q;;+1/p-1 |
| InChIKey | FPACVFGATBEJRA-UHFFFAOYSA-M |
| XLogP | -2.51 |
| TPSA | 65.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.20 |
| LogP ≤ 5 | -2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |