C23H23ClN4OS — CID 144874906
N-(4-tert-butylphenyl)sulfanyl-4-chloro-2-(2-methoxy-3-pyridinyl)pyrazolo[1,5-a]pyridin-7-amine (PubChem CID 144874906) has the molecular formula C23H23ClN4OS and a molecular weight of 438.98 g/mol. Its IUPAC name is N-(4-tert-butylphenyl)sulfanyl-4-chloro-2-(2-methoxy-3-pyridinyl)pyrazolo[1,5-a]pyridin-7-amine.
| Compound Name | N-(4-tert-butylphenyl)sulfanyl-4-chloro-2-(2-methoxy-3-pyridinyl)pyrazolo[1,5-a]pyridin-7-amine |
|---|---|
| PubChem CID | 144874906 |
| Molecular Formula | C23H23ClN4OS |
| Molecular Weight | 438.98 g/mol |
| Exact Mass | 438.13 |
| IUPAC Name | N-(4-tert-butylphenyl)sulfanyl-4-chloro-2-(2-methoxy-3-pyridinyl)pyrazolo[1,5-a]pyridin-7-amine |
| SMILES | COc1ncccc1-c1cc2c(Cl)ccc(NSc3ccc(C(C)(C)C)cc3)n2n1 |
| InChI | InChI=1S/C23H23ClN4OS/c1-23(2,3)15-7-9-16(10-8-15)30-27-21-12-11-18(24)20-14-19(26-28(20)21)17-6-5-13-25-22(17)29-4/h5-14,27H,1-4H3 |
| InChIKey | GUSIRMDJDLSDFI-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 51.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.98 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|