C27H32ClN3OS — CID 144874859
N-(4-tert-butylphenyl)sulfanyl-4-chloro-3-ethenyl-2-methylaniline;2-[ethenyl(methyl)amino]pyridin-3-ol (PubChem CID 144874859) has the molecular formula C27H32ClN3OS and a molecular weight of 482.09 g/mol. Its IUPAC name is N-(4-tert-butylphenyl)sulfanyl-4-chloro-3-ethenyl-2-methylaniline;2-[ethenyl(methyl)amino]pyridin-3-ol.
| Compound Name | N-(4-tert-butylphenyl)sulfanyl-4-chloro-3-ethenyl-2-methylaniline;2-[ethenyl(methyl)amino]pyridin-3-ol |
|---|---|
| PubChem CID | 144874859 |
| Molecular Formula | C27H32ClN3OS |
| Molecular Weight | 482.09 g/mol |
| Exact Mass | 481.20 |
| IUPAC Name | N-(4-tert-butylphenyl)sulfanyl-4-chloro-3-ethenyl-2-methylaniline;2-[ethenyl(methyl)amino]pyridin-3-ol |
| SMILES | C=CN(C)c1ncccc1O.C=Cc1c(Cl)ccc(NSc2ccc(C(C)(C)C)cc2)c1C |
| InChI | InChI=1S/C19H22ClNS.C8H10N2O/c1-6-16-13(2)18(12-11-17(16)20)21-22-15-9-7-14(8-10-15)19(3,4)5;1-3-10(2)8-7(11)5-4-6-9-8/h6-12,21H,1H2,2-5H3;3-6,11H,1H2,2H3 |
| InChIKey | LQHSGNMYTVKHHM-UHFFFAOYSA-N |
| XLogP | 8.08 |
| TPSA | 48.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.09 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|