C26H21Cl2FN2O2S — CID 144857661
5-[6-[(4-tert-butyl-3-fluorophenyl)sulfanylamino]-2,3-dichlorophenyl]quinoline-8-carboxylic acid (PubChem CID 144857661) has the molecular formula C26H21Cl2FN2O2S and a molecular weight of 515.44 g/mol. Its IUPAC name is 5-[6-[(4-tert-butyl-3-fluorophenyl)sulfanylamino]-2,3-dichlorophenyl]quinoline-8-carboxylic acid.
| Compound Name | 5-[6-[(4-tert-butyl-3-fluorophenyl)sulfanylamino]-2,3-dichlorophenyl]quinoline-8-carboxylic acid |
|---|---|
| PubChem CID | 144857661 |
| Molecular Formula | C26H21Cl2FN2O2S |
| Molecular Weight | 515.44 g/mol |
| Exact Mass | 514.07 |
| IUPAC Name | 5-[6-[(4-tert-butyl-3-fluorophenyl)sulfanylamino]-2,3-dichlorophenyl]quinoline-8-carboxylic acid |
| SMILES | CC(C)(C)c1ccc(SNc2ccc(Cl)c(Cl)c2-c2ccc(C(=O)O)c3ncccc23)cc1F |
| InChI | InChI=1S/C26H21Cl2FN2O2S/c1-26(2,3)18-9-6-14(13-20(18)29)34-31-21-11-10-19(27)23(28)22(21)15-7-8-17(25(32)33)24-16(15)5-4-12-30-24/h4-13,31H,1-3H3,(H,32,33) |
| InChIKey | IZWFQFINHJIJQN-UHFFFAOYSA-N |
| XLogP | 8.46 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.44 |
| LogP ≤ 5 | 8.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|