C27H20F3N2O6S- — CID 175003848
5-[6-(4-tert-butyl-3-fluoro-N-sulfinatoanilino)-2,2-difluoro-1,3-benzodioxol-5-yl]-8-carboxyquinoline (PubChem CID 175003848) has the molecular formula C27H20F3N2O6S- and a molecular weight of 557.53 g/mol. Its IUPAC name is 5-[6-(4-tert-butyl-3-fluoro-N-sulfinatoanilino)-2,2-difluoro-1,3-benzodioxol-5-yl]-8-carboxyquinoline.
| Compound Name | 5-[6-(4-tert-butyl-3-fluoro-N-sulfinatoanilino)-2,2-difluoro-1,3-benzodioxol-5-yl]-8-carboxyquinoline |
|---|---|
| PubChem CID | 175003848 |
| Molecular Formula | C27H20F3N2O6S- |
| Molecular Weight | 557.53 g/mol |
| Exact Mass | 557.10 |
| IUPAC Name | 5-[6-(4-tert-butyl-3-fluoro-N-sulfinatoanilino)-2,2-difluoro-1,3-benzodioxol-5-yl]-8-carboxyquinoline |
| SMILES | CC(C)(C)c1ccc(N(c2cc3c(cc2-c2ccc(C(=O)O)c4ncccc24)OC(F)(F)O3)S(=O)[O-])cc1F |
| InChI | InChI=1S/C27H21F3N2O6S/c1-26(2,3)19-9-6-14(11-20(19)28)32(39(35)36)21-13-23-22(37-27(29,30)38-23)12-18(21)15-7-8-17(25(33)34)24-16(15)5-4-10-31-24/h4-13H,1-3H3,(H,33,34)(H,35,36)/p-1 |
| InChIKey | ZKZQUHYAJXKGHH-UHFFFAOYSA-M |
| XLogP | 6.29 |
| TPSA | 112.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.53 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|