C26H20Cl2FN2O4S- — CID 175003395
5-[6-(4-tert-butyl-3-fluoro-N-sulfinatoanilino)-2,3-dichlorophenyl]-8-carboxyquinoline (PubChem CID 175003395) has the molecular formula C26H20Cl2FN2O4S- and a molecular weight of 546.43 g/mol. Its IUPAC name is 5-[6-(4-tert-butyl-3-fluoro-N-sulfinatoanilino)-2,3-dichlorophenyl]-8-carboxyquinoline.
| Compound Name | 5-[6-(4-tert-butyl-3-fluoro-N-sulfinatoanilino)-2,3-dichlorophenyl]-8-carboxyquinoline |
|---|---|
| PubChem CID | 175003395 |
| Molecular Formula | C26H20Cl2FN2O4S- |
| Molecular Weight | 546.43 g/mol |
| Exact Mass | 545.05 |
| IUPAC Name | 5-[6-(4-tert-butyl-3-fluoro-N-sulfinatoanilino)-2,3-dichlorophenyl]-8-carboxyquinoline |
| SMILES | CC(C)(C)c1ccc(N(c2ccc(Cl)c(Cl)c2-c2ccc(C(=O)O)c3ncccc23)S(=O)[O-])cc1F |
| InChI | InChI=1S/C26H21Cl2FN2O4S/c1-26(2,3)18-9-6-14(13-20(18)29)31(36(34)35)21-11-10-19(27)23(28)22(21)15-7-8-17(25(32)33)24-16(15)5-4-12-30-24/h4-13H,1-3H3,(H,32,33)(H,34,35)/p-1 |
| InChIKey | APUWLACVFBSBDV-UHFFFAOYSA-M |
| XLogP | 7.28 |
| TPSA | 93.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.43 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|