C16H17FN2O4 — CID 144877120
5-acetyl-1-(2-ethoxyethyl)-3-(4-fluorophenyl)pyrimidine-2,4-dione (PubChem CID 144877120) has the molecular formula C16H17FN2O4 and a molecular weight of 320.32 g/mol. Its IUPAC name is 5-acetyl-1-(2-ethoxyethyl)-3-(4-fluorophenyl)pyrimidine-2,4-dione.
| Compound Name | 5-acetyl-1-(2-ethoxyethyl)-3-(4-fluorophenyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 144877120 |
| Molecular Formula | C16H17FN2O4 |
| Molecular Weight | 320.32 g/mol |
| Exact Mass | 320.12 |
| IUPAC Name | 5-acetyl-1-(2-ethoxyethyl)-3-(4-fluorophenyl)pyrimidine-2,4-dione |
| SMILES | CCOCCn1cc(C(C)=O)c(=O)n(-c2ccc(F)cc2)c1=O |
| InChI | InChI=1S/C16H17FN2O4/c1-3-23-9-8-18-10-14(11(2)20)15(21)19(16(18)22)13-6-4-12(17)5-7-13/h4-7,10H,3,8-9H2,1-2H3 |
| InChIKey | YQDMZDAAKXDXGU-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 70.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.32 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|