About ethoxyethane;1-(4-fluorophenyl)-6-oxo-3-propan-2-ylpyridine-2,5-dicarboxylic acid
ethoxyethane;1-(4-fluorophenyl)-6-oxo-3-propan-2-ylpyridine-2,5-dicarboxylic acid (PubChem CID 146424705) has the molecular formula C20H24FNO6
and a molecular weight of 393.41 g/mol. Its IUPAC name is ethoxyethane;1-(4-fluorophenyl)-6-oxo-3-propan-2-ylpyridine-2,5-dicarboxylic acid.
Molecular Properties
| Compound Name | ethoxyethane;1-(4-fluorophenyl)-6-oxo-3-propan-2-ylpyridine-2,5-dicarboxylic acid |
| PubChem CID | 146424705 |
| Molecular Formula | C20H24FNO6 |
| Molecular Weight | 393.41 g/mol |
| Exact Mass | 393.16 |
| IUPAC Name | ethoxyethane;1-(4-fluorophenyl)-6-oxo-3-propan-2-ylpyridine-2,5-dicarboxylic acid |
| SMILES | CC(C)c1cc(C(=O)O)c(=O)n(-c2ccc(F)cc2)c1C(=O)O.CCOCC |
| InChI | InChI=1S/C16H14FNO5.C4H10O/c1-8(2)11-7-12(15(20)21)14(19)18(13(11)16(22)23)10-5-3-9(17)4-6-10;1-3-5-4-2/h3-8H,1-2H3,(H,20,21)(H,22,23);3-4H2,1-2H3 |
| InChIKey | KQGJJANWFZCVGN-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 105.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 393.41 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethoxyethane;1-(4-fluorophenyl)-6-oxo-3-propan-2-ylpyridine-2,5-dicarboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethoxyethane;1-(4-fluorophenyl)-6-oxo-3-propan-2-ylpyridine-2,5-dicarboxylic acid?
The IUPAC name of ethoxyethane;1-(4-fluorophenyl)-6-oxo-3-propan-2-ylpyridine-2,5-dicarboxylic acid (CID 146424705) is ethoxyethane;1-(4-fluorophenyl)-6-oxo-3-propan-2-ylpyridine-2,5-dicarboxylic acid.
What is the SMILES notation for ethoxyethane;1-(4-fluorophenyl)-6-oxo-3-propan-2-ylpyridine-2,5-dicarboxylic acid?
The canonical SMILES for ethoxyethane;1-(4-fluorophenyl)-6-oxo-3-propan-2-ylpyridine-2,5-dicarboxylic acid is CC(C)c1cc(C(=O)O)c(=O)n(-c2ccc(F)cc2)c1C(=O)O.CCOCC.
What is the InChIKey of ethoxyethane;1-(4-fluorophenyl)-6-oxo-3-propan-2-ylpyridine-2,5-dicarboxylic acid?
The InChIKey is KQGJJANWFZCVGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14FNO5.C4H10O/c1-8(2)11-7-12(15(20)21)14(19)18(13(11)16(22)23)10-5-3-9(17)4-6-10;1-3-5-4-2/h3-8H,1-2H3,(H,20,21)(H,22,23);3-4H2,1-2H3.
What are the key properties of ethoxyethane;1-(4-fluorophenyl)-6-oxo-3-propan-2-ylpyridine-2,5-dicarboxylic acid?
ethoxyethane;1-(4-fluorophenyl)-6-oxo-3-propan-2-ylpyridine-2,5-dicarboxylic acid has a molecular weight of 393.41 g/mol, XLogP of 3.54, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethoxyethane;1-(4-fluorophenyl)-6-oxo-3-propan-2-ylpyridine-2,5-dicarboxylic acid is sourced from PubChem (CID 146424705), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).