C20H16ClF2N3O3S — CID 144878287
[5-[3-[[amino-[(Z)-2-aminoethenyl]amino]methyl]-5-chloro-4-hydroxyphenyl]thiophen-2-yl]-(2,6-difluoro-3-hydroxyphenyl)methanone (PubChem CID 144878287) has the molecular formula C20H16ClF2N3O3S and a molecular weight of 451.88 g/mol. Its IUPAC name is [5-[3-[[amino-[(Z)-2-aminoethenyl]amino]methyl]-5-chloro-4-hydroxyphenyl]thiophen-2-yl]-(2,6-difluoro-3-hydroxyphenyl)methanone.
| Compound Name | [5-[3-[[amino-[(Z)-2-aminoethenyl]amino]methyl]-5-chloro-4-hydroxyphenyl]thiophen-2-yl]-(2,6-difluoro-3-hydroxyphenyl)methanone |
|---|---|
| PubChem CID | 144878287 |
| Molecular Formula | C20H16ClF2N3O3S |
| Molecular Weight | 451.88 g/mol |
| Exact Mass | 451.06 |
| IUPAC Name | [5-[3-[[amino-[(Z)-2-aminoethenyl]amino]methyl]-5-chloro-4-hydroxyphenyl]thiophen-2-yl]-(2,6-difluoro-3-hydroxyphenyl)methanone |
| SMILES | N/C=C\N(N)Cc1cc(-c2ccc(C(=O)c3c(F)ccc(O)c3F)s2)cc(Cl)c1O |
| InChI | InChI=1S/C20H16ClF2N3O3S/c21-12-8-10(7-11(19(12)28)9-26(25)6-5-24)15-3-4-16(30-15)20(29)17-13(22)1-2-14(27)18(17)23/h1-8,27-28H,9,24-25H2/b6-5- |
| InChIKey | JXSNQOPCCWNOKN-WAYWQWQTSA-N |
| XLogP | 4.09 |
| TPSA | 112.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.88 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|