C40H25N2O2P — CID 144879283
3-[4-[18-(4-pyridin-3-ylphenyl)-8,14-dioxa-1-phosphapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9(21),10,12,15(20),16,18-nonaen-4-yl]phenyl]pyridine (PubChem CID 144879283) has the molecular formula C40H25N2O2P and a molecular weight of 596.63 g/mol. Its IUPAC name is 3-[4-[18-(4-pyridin-3-ylphenyl)-8,14-dioxa-1-phosphapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9(21),10,12,15(20),16,18-nonaen-4-yl]phenyl]pyridine.
| Compound Name | 3-[4-[18-(4-pyridin-3-ylphenyl)-8,14-dioxa-1-phosphapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9(21),10,12,15(20),16,18-nonaen-4-yl]phenyl]pyridine |
|---|---|
| PubChem CID | 144879283 |
| Molecular Formula | C40H25N2O2P |
| Molecular Weight | 596.63 g/mol |
| Exact Mass | 596.17 |
| IUPAC Name | 3-[4-[18-(4-pyridin-3-ylphenyl)-8,14-dioxa-1-phosphapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9(21),10,12,15(20),16,18-nonaen-4-yl]phenyl]pyridine |
| SMILES | c1cncc(-c2ccc(-c3ccc4c(c3)P3c5cc(-c6ccc(-c7cccnc7)cc6)ccc5Oc5cccc(c53)O4)cc2)c1 |
| InChI | InChI=1S/C40H25N2O2P/c1-6-36-40-37(7-1)44-35-19-17-31(27-10-14-29(15-11-27)33-5-3-21-42-25-33)23-39(35)45(40)38-22-30(16-18-34(38)43-36)26-8-12-28(13-9-26)32-4-2-20-41-24-32/h1-25H |
| InChIKey | MTLZYAPCFFADAF-UHFFFAOYSA-N |
| XLogP | 9.11 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.63 |
| LogP ≤ 5 | 9.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|