C23H27N5O2 — CID 144881007
N-(2-iminopropyl)-3-[4-[(2-oxo-1-pyridinyl)methyl]anilino]benzamide;methanamine (PubChem CID 144881007) has the molecular formula C23H27N5O2 and a molecular weight of 405.50 g/mol. Its IUPAC name is N-(2-iminopropyl)-3-[4-[(2-oxo-1-pyridinyl)methyl]anilino]benzamide;methanamine.
| Compound Name | N-(2-iminopropyl)-3-[4-[(2-oxo-1-pyridinyl)methyl]anilino]benzamide;methanamine |
|---|---|
| PubChem CID | 144881007 |
| Molecular Formula | C23H27N5O2 |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.22 |
| IUPAC Name | N-(2-iminopropyl)-3-[4-[(2-oxo-1-pyridinyl)methyl]anilino]benzamide;methanamine |
| SMILES | CN.[H]/N=C(\C)CNC(=O)c1cccc(Nc2ccc(Cn3ccccc3=O)cc2)c1 |
| InChI | InChI=1S/C22H22N4O2.CH5N/c1-16(23)14-24-22(28)18-5-4-6-20(13-18)25-19-10-8-17(9-11-19)15-26-12-3-2-7-21(26)27;1-2/h2-13,23,25H,14-15H2,1H3,(H,24,28);2H2,1H3/b23-16+; |
| InChIKey | OLIRUZOOGKHFRA-BVXBIMGVSA-N |
| XLogP | 2.98 |
| TPSA | 113.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|