C28H38ClNO3 — CID 144882585
(3-chlorophenyl)-[3-[[4-[(2-methylpropan-2-yl)oxy]phenoxy]methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]methanone;propane (PubChem CID 144882585) has the molecular formula C28H38ClNO3 and a molecular weight of 472.07 g/mol. Its IUPAC name is (3-chlorophenyl)-[3-[[4-[(2-methylpropan-2-yl)oxy]phenoxy]methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]methanone;propane.
| Compound Name | (3-chlorophenyl)-[3-[[4-[(2-methylpropan-2-yl)oxy]phenoxy]methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]methanone;propane |
|---|---|
| PubChem CID | 144882585 |
| Molecular Formula | C28H38ClNO3 |
| Molecular Weight | 472.07 g/mol |
| Exact Mass | 471.25 |
| IUPAC Name | (3-chlorophenyl)-[3-[[4-[(2-methylpropan-2-yl)oxy]phenoxy]methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]methanone;propane |
| SMILES | CC(C)(C)Oc1ccc(OCC2C3CCCC3CN2C(=O)c2cccc(Cl)c2)cc1.CCC |
| InChI | InChI=1S/C25H30ClNO3.C3H8/c1-25(2,3)30-21-12-10-20(11-13-21)29-16-23-22-9-5-7-18(22)15-27(23)24(28)17-6-4-8-19(26)14-17;1-3-2/h4,6,8,10-14,18,22-23H,5,7,9,15-16H2,1-3H3;3H2,1-2H3 |
| InChIKey | JJYMCKUHBCZQER-UHFFFAOYSA-N |
| XLogP | 7.25 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.07 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |