About 6-cyclohexylthiazinane;ethane
6-cyclohexylthiazinane;ethane (PubChem CID 144883363) has the molecular formula C12H25NS
and a molecular weight of 215.41 g/mol. Its IUPAC name is 6-cyclohexylthiazinane;ethane.
Molecular Properties
| Compound Name | 6-cyclohexylthiazinane;ethane |
| PubChem CID | 144883363 |
| Molecular Formula | C12H25NS |
| Molecular Weight | 215.41 g/mol |
| Exact Mass | 215.17 |
| IUPAC Name | 6-cyclohexylthiazinane;ethane |
| SMILES | C1CCC(C2CCCNS2)CC1.CC |
| InChI | InChI=1S/C10H19NS.C2H6/c1-2-5-9(6-3-1)10-7-4-8-11-12-10;1-2/h9-11H,1-8H2;1-2H3 |
| InChIKey | XWMJKZSUPINUQM-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.41 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-cyclohexylthiazinane;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-cyclohexylthiazinane;ethane?
The IUPAC name of 6-cyclohexylthiazinane;ethane (CID 144883363) is 6-cyclohexylthiazinane;ethane.
What is the SMILES notation for 6-cyclohexylthiazinane;ethane?
The canonical SMILES for 6-cyclohexylthiazinane;ethane is C1CCC(C2CCCNS2)CC1.CC.
What is the InChIKey of 6-cyclohexylthiazinane;ethane?
The InChIKey is XWMJKZSUPINUQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19NS.C2H6/c1-2-5-9(6-3-1)10-7-4-8-11-12-10;1-2/h9-11H,1-8H2;1-2H3.
What are the key properties of 6-cyclohexylthiazinane;ethane?
6-cyclohexylthiazinane;ethane has a molecular weight of 215.41 g/mol, XLogP of 3.99, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-cyclohexylthiazinane;ethane is sourced from PubChem (CID 144883363), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).