C24H24F4N6O4S2 — CID 144885608
2-[6-[4-[amino(methanimidoyl)amino]phenyl]-5-fluoro-1,3-benzothiazol-2-yl]-N-[2-(cyclopropylamino)-2-oxoethyl]-2-(3,3,3-trifluoropropylsulfonyl)acetamide (PubChem CID 144885608) has the molecular formula C24H24F4N6O4S2 and a molecular weight of 600.62 g/mol. Its IUPAC name is 2-[6-[4-[amino(methanimidoyl)amino]phenyl]-5-fluoro-1,3-benzothiazol-2-yl]-N-[2-(cyclopropylamino)-2-oxoethyl]-2-(3,3,3-trifluoropropylsulfonyl)acetamide.
| Compound Name | 2-[6-[4-[amino(methanimidoyl)amino]phenyl]-5-fluoro-1,3-benzothiazol-2-yl]-N-[2-(cyclopropylamino)-2-oxoethyl]-2-(3,3,3-trifluoropropylsulfonyl)acetamide |
|---|---|
| PubChem CID | 144885608 |
| Molecular Formula | C24H24F4N6O4S2 |
| Molecular Weight | 600.62 g/mol |
| Exact Mass | 600.12 |
| IUPAC Name | 2-[6-[4-[amino(methanimidoyl)amino]phenyl]-5-fluoro-1,3-benzothiazol-2-yl]-N-[2-(cyclopropylamino)-2-oxoethyl]-2-(3,3,3-trifluoropropylsulfonyl)acetamide |
| SMILES | [H]/N=C/N(N)c1ccc(-c2cc3sc(C(C(=O)NCC(=O)NC4CC4)S(=O)(=O)CCC(F)(F)F)nc3cc2F)cc1 |
| InChI | InChI=1S/C24H24F4N6O4S2/c25-17-10-18-19(9-16(17)13-1-5-15(6-2-13)34(30)12-29)39-23(33-18)21(40(37,38)8-7-24(26,27)28)22(36)31-11-20(35)32-14-3-4-14/h1-2,5-6,9-10,12,14,21,29H,3-4,7-8,11,30H2,(H,31,36)(H,32,35)/b29-12+ |
| InChIKey | ISHUFXVPFPPZAQ-XKJRVUDJSA-N |
| XLogP | 3.19 |
| TPSA | 158.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.62 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|