C37H49N — CID 144887935
4-[1-[(1E,3Z,5Z)-4-methylhepta-1,3,5-trienyl]cyclohexyl]-N-[(2E,4Z,6Z)-6-methylocta-2,4,6-trien-3-yl]-N-[(2Z,4E,6E)-octa-2,4,6-trien-4-yl]aniline (PubChem CID 144887935) has the molecular formula C37H49N and a molecular weight of 507.81 g/mol. Its IUPAC name is 4-[1-[(1E,3Z,5Z)-4-methylhepta-1,3,5-trienyl]cyclohexyl]-N-[(2E,4Z,6Z)-6-methylocta-2,4,6-trien-3-yl]-N-[(2Z,4E,6E)-octa-2,4,6-trien-4-yl]aniline.
| Compound Name | 4-[1-[(1E,3Z,5Z)-4-methylhepta-1,3,5-trienyl]cyclohexyl]-N-[(2E,4Z,6Z)-6-methylocta-2,4,6-trien-3-yl]-N-[(2Z,4E,6E)-octa-2,4,6-trien-4-yl]aniline |
|---|---|
| PubChem CID | 144887935 |
| Molecular Formula | C37H49N |
| Molecular Weight | 507.81 g/mol |
| Exact Mass | 507.39 |
| IUPAC Name | 4-[1-[(1E,3Z,5Z)-4-methylhepta-1,3,5-trienyl]cyclohexyl]-N-[(2E,4Z,6Z)-6-methylocta-2,4,6-trien-3-yl]-N-[(2Z,4E,6E)-octa-2,4,6-trien-4-yl]aniline |
| SMILES | C/C=C\C(C)=C/C=C/C1(c2ccc(N(C(/C=C\C(C)=C/C)=C/C)C(/C=C\C)=C/C=C/C)cc2)CCCCC1 |
| InChI | InChI=1S/C37H49N/c1-8-13-21-35(19-10-3)38(34(12-5)25-22-31(6)11-4)36-26-23-33(24-27-36)37(28-15-14-16-29-37)30-17-20-32(7)18-9-2/h8-13,17-27,30H,14-16,28-29H2,1-7H3/b13-8+,18-9-,19-10-,25-22-,30-17+,31-11-,32-20-,34-12+,35-21+ |
| InChIKey | SMZGMNBSQQFFBJ-KCEFINNUSA-N |
| XLogP | 11.24 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.81 |
| LogP ≤ 5 | 11.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|