C14H21F3N2 — CID 144888846
1-[(3E,5Z)-5-methyl-2-methylidene-3-(trifluoromethyl)hepta-3,5-dienyl]piperazine (PubChem CID 144888846) has the molecular formula C14H21F3N2 and a molecular weight of 274.33 g/mol. Its IUPAC name is 1-[(3E,5Z)-5-methyl-2-methylidene-3-(trifluoromethyl)hepta-3,5-dienyl]piperazine.
| Compound Name | 1-[(3E,5Z)-5-methyl-2-methylidene-3-(trifluoromethyl)hepta-3,5-dienyl]piperazine |
|---|---|
| PubChem CID | 144888846 |
| Molecular Formula | C14H21F3N2 |
| Molecular Weight | 274.33 g/mol |
| Exact Mass | 274.17 |
| IUPAC Name | 1-[(3E,5Z)-5-methyl-2-methylidene-3-(trifluoromethyl)hepta-3,5-dienyl]piperazine |
| SMILES | C=C(CN1CCNCC1)/C(=C\C(C)=C/C)C(F)(F)F |
| InChI | InChI=1S/C14H21F3N2/c1-4-11(2)9-13(14(15,16)17)12(3)10-19-7-5-18-6-8-19/h4,9,18H,3,5-8,10H2,1-2H3/b11-4-,13-9+ |
| InChIKey | XZOMVPYMQNAYEK-QVGMEQOVSA-N |
| XLogP | 2.90 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.33 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|