C31H39F3N6O — CID 144888858
ethane;N-[4-[(4-ethylpiperazin-1-yl)methyl]-3-(trifluoromethyl)phenyl]formamide;5-[2-[4-(methylamino)phenyl]ethynyl]pyridin-2-amine (PubChem CID 144888858) has the molecular formula C31H39F3N6O and a molecular weight of 568.69 g/mol. Its IUPAC name is ethane;N-[4-[(4-ethylpiperazin-1-yl)methyl]-3-(trifluoromethyl)phenyl]formamide;5-[2-[4-(methylamino)phenyl]ethynyl]pyridin-2-amine.
| Compound Name | ethane;N-[4-[(4-ethylpiperazin-1-yl)methyl]-3-(trifluoromethyl)phenyl]formamide;5-[2-[4-(methylamino)phenyl]ethynyl]pyridin-2-amine |
|---|---|
| PubChem CID | 144888858 |
| Molecular Formula | C31H39F3N6O |
| Molecular Weight | 568.69 g/mol |
| Exact Mass | 568.31 |
| IUPAC Name | ethane;N-[4-[(4-ethylpiperazin-1-yl)methyl]-3-(trifluoromethyl)phenyl]formamide;5-[2-[4-(methylamino)phenyl]ethynyl]pyridin-2-amine |
| SMILES | CC.CCN1CCN(Cc2ccc(NC=O)cc2C(F)(F)F)CC1.CNc1ccc(C#Cc2ccc(N)nc2)cc1 |
| InChI | InChI=1S/C15H20F3N3O.C14H13N3.C2H6/c1-2-20-5-7-21(8-6-20)10-12-3-4-13(19-11-22)9-14(12)15(16,17)18;1-16-13-7-4-11(5-8-13)2-3-12-6-9-14(15)17-10-12;1-2/h3-4,9,11H,2,5-8,10H2,1H3,(H,19,22);4-10,16H,1H3,(H2,15,17);1-2H3 |
| InChIKey | OSYXQOWOJXNHHX-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 86.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.69 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|