C28H31F3N8O — CID 144888620
N-[4-[2-(6-amino-5-methanimidoyl-3-pyridinyl)ethynyl]-2-pyridinyl]formamide;N-methyl-4-[(4-methylpiperazin-1-yl)methyl]-3-(trifluoromethyl)aniline (PubChem CID 144888620) has the molecular formula C28H31F3N8O and a molecular weight of 552.61 g/mol. Its IUPAC name is N-[4-[2-(6-amino-5-methanimidoyl-3-pyridinyl)ethynyl]-2-pyridinyl]formamide;N-methyl-4-[(4-methylpiperazin-1-yl)methyl]-3-(trifluoromethyl)aniline.
| Compound Name | N-[4-[2-(6-amino-5-methanimidoyl-3-pyridinyl)ethynyl]-2-pyridinyl]formamide;N-methyl-4-[(4-methylpiperazin-1-yl)methyl]-3-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 144888620 |
| Molecular Formula | C28H31F3N8O |
| Molecular Weight | 552.61 g/mol |
| Exact Mass | 552.26 |
| IUPAC Name | N-[4-[2-(6-amino-5-methanimidoyl-3-pyridinyl)ethynyl]-2-pyridinyl]formamide;N-methyl-4-[(4-methylpiperazin-1-yl)methyl]-3-(trifluoromethyl)aniline |
| SMILES | CNc1ccc(CN2CCN(C)CC2)c(C(F)(F)F)c1.[H]/N=C/c1cc(C#Cc2ccnc(NC=O)c2)cnc1N |
| InChI | InChI=1S/C14H20F3N3.C14H11N5O/c1-18-12-4-3-11(13(9-12)14(15,16)17)10-20-7-5-19(2)6-8-20;15-7-12-5-11(8-18-14(12)16)2-1-10-3-4-17-13(6-10)19-9-20/h3-4,9,18H,5-8,10H2,1-2H3;3-9,15H,(H2,16,18)(H,17,19,20)/b;15-7+ |
| InChIKey | ZRMRZXXFEVIXLO-GXBBCAPKSA-N |
| XLogP | 3.52 |
| TPSA | 123.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.61 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|