C27H26F3N5O — CID 146386705
3-[2-(2-amino-3-pyridinyl)ethynyl]-N-[4-[(4-methylpiperazin-1-yl)methyl]-3-(trifluoromethyl)phenyl]benzamide (PubChem CID 146386705) has the molecular formula C27H26F3N5O and a molecular weight of 493.53 g/mol. Its IUPAC name is 3-[2-(2-amino-3-pyridinyl)ethynyl]-N-[4-[(4-methylpiperazin-1-yl)methyl]-3-(trifluoromethyl)phenyl]benzamide.
| Compound Name | 3-[2-(2-amino-3-pyridinyl)ethynyl]-N-[4-[(4-methylpiperazin-1-yl)methyl]-3-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 146386705 |
| Molecular Formula | C27H26F3N5O |
| Molecular Weight | 493.53 g/mol |
| Exact Mass | 493.21 |
| IUPAC Name | 3-[2-(2-amino-3-pyridinyl)ethynyl]-N-[4-[(4-methylpiperazin-1-yl)methyl]-3-(trifluoromethyl)phenyl]benzamide |
| SMILES | CN1CCN(Cc2ccc(NC(=O)c3cccc(C#Cc4cccnc4N)c3)cc2C(F)(F)F)CC1 |
| InChI | InChI=1S/C27H26F3N5O/c1-34-12-14-35(15-13-34)18-22-9-10-23(17-24(22)27(28,29)30)33-26(36)21-5-2-4-19(16-21)7-8-20-6-3-11-32-25(20)31/h2-6,9-11,16-17H,12-15,18H2,1H3,(H2,31,32)(H,33,36) |
| InChIKey | IESCCTZXMLJICS-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 74.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.53 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|