C32H34F3N5O — CID 144752862
3-[3-imino-3-(2-methanimidoylphenyl)prop-1-ynyl]-N,4-dimethylaniline;4-[(4-methylpiperazin-1-yl)methyl]-3-(trifluoromethyl)benzaldehyde (PubChem CID 144752862) has the molecular formula C32H34F3N5O and a molecular weight of 561.65 g/mol. Its IUPAC name is 3-[3-imino-3-(2-methanimidoylphenyl)prop-1-ynyl]-N,4-dimethylaniline;4-[(4-methylpiperazin-1-yl)methyl]-3-(trifluoromethyl)benzaldehyde.
| Compound Name | 3-[3-imino-3-(2-methanimidoylphenyl)prop-1-ynyl]-N,4-dimethylaniline;4-[(4-methylpiperazin-1-yl)methyl]-3-(trifluoromethyl)benzaldehyde |
|---|---|
| PubChem CID | 144752862 |
| Molecular Formula | C32H34F3N5O |
| Molecular Weight | 561.65 g/mol |
| Exact Mass | 561.27 |
| IUPAC Name | 3-[3-imino-3-(2-methanimidoylphenyl)prop-1-ynyl]-N,4-dimethylaniline;4-[(4-methylpiperazin-1-yl)methyl]-3-(trifluoromethyl)benzaldehyde |
| SMILES | CN1CCN(Cc2ccc(C=O)cc2C(F)(F)F)CC1.[H]/N=C\c1ccccc1/C(C#Cc1cc(NC)ccc1C)=N/[H] |
| InChI | InChI=1S/C18H17N3.C14H17F3N2O/c1-13-7-9-16(21-2)11-14(13)8-10-18(20)17-6-4-3-5-15(17)12-19;1-18-4-6-19(7-5-18)9-12-3-2-11(10-20)8-13(12)14(15,16)17/h3-7,9,11-12,19-21H,1-2H3;2-3,8,10H,4-7,9H2,1H3/b19-12-,20-18+; |
| InChIKey | SSZALJOTWKUCMS-YUKWXYLJSA-N |
| XLogP | 5.72 |
| TPSA | 83.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.65 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|