C22H37N3O4 — CID 144890144
N-[2-(tert-butylamino)ethyl]-2-[2-[2-[3-(2-methylpropyl)anilino]-2-oxoethoxy]ethoxy]acetamide (PubChem CID 144890144) has the molecular formula C22H37N3O4 and a molecular weight of 407.56 g/mol. Its IUPAC name is N-[2-(tert-butylamino)ethyl]-2-[2-[2-[3-(2-methylpropyl)anilino]-2-oxoethoxy]ethoxy]acetamide.
| Compound Name | N-[2-(tert-butylamino)ethyl]-2-[2-[2-[3-(2-methylpropyl)anilino]-2-oxoethoxy]ethoxy]acetamide |
|---|---|
| PubChem CID | 144890144 |
| Molecular Formula | C22H37N3O4 |
| Molecular Weight | 407.56 g/mol |
| Exact Mass | 407.28 |
| IUPAC Name | N-[2-(tert-butylamino)ethyl]-2-[2-[2-[3-(2-methylpropyl)anilino]-2-oxoethoxy]ethoxy]acetamide |
| SMILES | CC(C)Cc1cccc(NC(=O)COCCOCC(=O)NCCNC(C)(C)C)c1 |
| InChI | InChI=1S/C22H37N3O4/c1-17(2)13-18-7-6-8-19(14-18)25-21(27)16-29-12-11-28-15-20(26)23-9-10-24-22(3,4)5/h6-8,14,17,24H,9-13,15-16H2,1-5H3,(H,23,26)(H,25,27) |
| InChIKey | WWYVWDDLWWJPGJ-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.56 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|