C43H60N4O8 — CID 160658755
N-butyl-2-[2-[2-(3-ethylanilino)-2-oxoethoxy]ethoxy]acetamide;N-butyl-2-[2-[2-oxo-2-[4-(4-prop-1-enylphenyl)anilino]ethoxy]ethoxy]acetamide (PubChem CID 160658755) has the molecular formula C43H60N4O8 and a molecular weight of 760.97 g/mol. Its IUPAC name is N-butyl-2-[2-[2-(3-ethylanilino)-2-oxoethoxy]ethoxy]acetamide;N-butyl-2-[2-[2-oxo-2-[4-(4-prop-1-enylphenyl)anilino]ethoxy]ethoxy]acetamide.
| Compound Name | N-butyl-2-[2-[2-(3-ethylanilino)-2-oxoethoxy]ethoxy]acetamide;N-butyl-2-[2-[2-oxo-2-[4-(4-prop-1-enylphenyl)anilino]ethoxy]ethoxy]acetamide |
|---|---|
| PubChem CID | 160658755 |
| Molecular Formula | C43H60N4O8 |
| Molecular Weight | 760.97 g/mol |
| Exact Mass | 760.44 |
| IUPAC Name | N-butyl-2-[2-[2-(3-ethylanilino)-2-oxoethoxy]ethoxy]acetamide;N-butyl-2-[2-[2-oxo-2-[4-(4-prop-1-enylphenyl)anilino]ethoxy]ethoxy]acetamide |
| SMILES | CC=Cc1ccc(-c2ccc(NC(=O)COCCOCC(=O)NCCCC)cc2)cc1.CCCCNC(=O)COCCOCC(=O)Nc1cccc(CC)c1 |
| InChI | InChI=1S/C25H32N2O4.C18H28N2O4/c1-3-5-15-26-24(28)18-30-16-17-31-19-25(29)27-23-13-11-22(12-14-23)21-9-7-20(6-4-2)8-10-21;1-3-5-9-19-17(21)13-23-10-11-24-14-18(22)20-16-8-6-7-15(4-2)12-16/h4,6-14H,3,5,15-19H2,1-2H3,(H,26,28)(H,27,29);6-8,12H,3-5,9-11,13-14H2,1-2H3,(H,19,21)(H,20,22) |
| InChIKey | RLJXCRGHDOZXBQ-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 153.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 760.97 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|