C23H34N2O2 — CID 70392592
N-ethylbutan-1-amine;N-(3-ethylphenyl)-2-phenylmethoxyacetamide (PubChem CID 70392592) has the molecular formula C23H34N2O2 and a molecular weight of 370.54 g/mol. Its IUPAC name is N-ethylbutan-1-amine;N-(3-ethylphenyl)-2-phenylmethoxyacetamide.
| Compound Name | N-ethylbutan-1-amine;N-(3-ethylphenyl)-2-phenylmethoxyacetamide |
|---|---|
| PubChem CID | 70392592 |
| Molecular Formula | C23H34N2O2 |
| Molecular Weight | 370.54 g/mol |
| Exact Mass | 370.26 |
| IUPAC Name | N-ethylbutan-1-amine;N-(3-ethylphenyl)-2-phenylmethoxyacetamide |
| SMILES | CCCCNCC.CCc1cccc(NC(=O)COCc2ccccc2)c1 |
| InChI | InChI=1S/C17H19NO2.C6H15N/c1-2-14-9-6-10-16(11-14)18-17(19)13-20-12-15-7-4-3-5-8-15;1-3-5-6-7-4-2/h3-11H,2,12-13H2,1H3,(H,18,19);7H,3-6H2,1-2H3 |
| InChIKey | FDPYKRBITOGSDZ-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.54 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|