C24H36N2O2 — CID 70392482
N-(3-ethylphenyl)-2-phenylmethoxyacetamide;2-methyl-N-propylpropan-2-amine (PubChem CID 70392482) has the molecular formula C24H36N2O2 and a molecular weight of 384.56 g/mol. Its IUPAC name is N-(3-ethylphenyl)-2-phenylmethoxyacetamide;2-methyl-N-propylpropan-2-amine.
| Compound Name | N-(3-ethylphenyl)-2-phenylmethoxyacetamide;2-methyl-N-propylpropan-2-amine |
|---|---|
| PubChem CID | 70392482 |
| Molecular Formula | C24H36N2O2 |
| Molecular Weight | 384.56 g/mol |
| Exact Mass | 384.28 |
| IUPAC Name | N-(3-ethylphenyl)-2-phenylmethoxyacetamide;2-methyl-N-propylpropan-2-amine |
| SMILES | CCCNC(C)(C)C.CCc1cccc(NC(=O)COCc2ccccc2)c1 |
| InChI | InChI=1S/C17H19NO2.C7H17N/c1-2-14-9-6-10-16(11-14)18-17(19)13-20-12-15-7-4-3-5-8-15;1-5-6-8-7(2,3)4/h3-11H,2,12-13H2,1H3,(H,18,19);8H,5-6H2,1-4H3 |
| InChIKey | MKBCXRPMNXDQCP-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.56 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |