About N-ethylbutan-1-amine;N-(3-ethylphenyl)formamide
N-ethylbutan-1-amine;N-(3-ethylphenyl)formamide (PubChem CID 88630078) has the molecular formula C15H26N2O
and a molecular weight of 250.39 g/mol. Its IUPAC name is N-ethylbutan-1-amine;N-(3-ethylphenyl)formamide.
Molecular Properties
| Compound Name | N-ethylbutan-1-amine;N-(3-ethylphenyl)formamide |
| PubChem CID | 88630078 |
| Molecular Formula | C15H26N2O |
| Molecular Weight | 250.39 g/mol |
| Exact Mass | 250.20 |
| IUPAC Name | N-ethylbutan-1-amine;N-(3-ethylphenyl)formamide |
| SMILES | CCCCNCC.CCc1cccc(NC=O)c1 |
| InChI | InChI=1S/C9H11NO.C6H15N/c1-2-8-4-3-5-9(6-8)10-7-11;1-3-5-6-7-4-2/h3-7H,2H2,1H3,(H,10,11);7H,3-6H2,1-2H3 |
| InChIKey | GDFHIZRKMQRNTC-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.39 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-ethylbutan-1-amine;N-(3-ethylphenyl)formamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethylbutan-1-amine;N-(3-ethylphenyl)formamide?
The IUPAC name of N-ethylbutan-1-amine;N-(3-ethylphenyl)formamide (CID 88630078) is N-ethylbutan-1-amine;N-(3-ethylphenyl)formamide.
What is the SMILES notation for N-ethylbutan-1-amine;N-(3-ethylphenyl)formamide?
The canonical SMILES for N-ethylbutan-1-amine;N-(3-ethylphenyl)formamide is CCCCNCC.CCc1cccc(NC=O)c1.
What is the InChIKey of N-ethylbutan-1-amine;N-(3-ethylphenyl)formamide?
The InChIKey is GDFHIZRKMQRNTC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO.C6H15N/c1-2-8-4-3-5-9(6-8)10-7-11;1-3-5-6-7-4-2/h3-7H,2H2,1H3,(H,10,11);7H,3-6H2,1-2H3.
What are the key properties of N-ethylbutan-1-amine;N-(3-ethylphenyl)formamide?
N-ethylbutan-1-amine;N-(3-ethylphenyl)formamide has a molecular weight of 250.39 g/mol, XLogP of 3.21, 7 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethylbutan-1-amine;N-(3-ethylphenyl)formamide is sourced from PubChem (CID 88630078), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).