C25H35N3O5 — CID 143322307
2-[2-(3-formamidophenyl)ethylamino]-2-phenylacetic acid;N-hydroxyoctanamide (PubChem CID 143322307) has the molecular formula C25H35N3O5 and a molecular weight of 457.57 g/mol. Its IUPAC name is 2-[2-(3-formamidophenyl)ethylamino]-2-phenylacetic acid;N-hydroxyoctanamide.
| Compound Name | 2-[2-(3-formamidophenyl)ethylamino]-2-phenylacetic acid;N-hydroxyoctanamide |
|---|---|
| PubChem CID | 143322307 |
| Molecular Formula | C25H35N3O5 |
| Molecular Weight | 457.57 g/mol |
| Exact Mass | 457.26 |
| IUPAC Name | 2-[2-(3-formamidophenyl)ethylamino]-2-phenylacetic acid;N-hydroxyoctanamide |
| SMILES | CCCCCCCC(=O)NO.O=CNc1cccc(CCNC(C(=O)O)c2ccccc2)c1 |
| InChI | InChI=1S/C17H18N2O3.C8H17NO2/c20-12-19-15-8-4-5-13(11-15)9-10-18-16(17(21)22)14-6-2-1-3-7-14;1-2-3-4-5-6-7-8(10)9-11/h1-8,11-12,16,18H,9-10H2,(H,19,20)(H,21,22);11H,2-7H2,1H3,(H,9,10) |
| InChIKey | VTMGUKSVAKQKJW-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 127.76 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.57 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|