C16H29N3O — CID 70474371
(3-ethylphenyl)urea;N-propylbutan-1-amine (PubChem CID 70474371) has the molecular formula C16H29N3O and a molecular weight of 279.43 g/mol. Its IUPAC name is (3-ethylphenyl)urea;N-propylbutan-1-amine.
| Compound Name | (3-ethylphenyl)urea;N-propylbutan-1-amine |
|---|---|
| PubChem CID | 70474371 |
| Molecular Formula | C16H29N3O |
| Molecular Weight | 279.43 g/mol |
| Exact Mass | 279.23 |
| IUPAC Name | (3-ethylphenyl)urea;N-propylbutan-1-amine |
| SMILES | CCCCNCCC.CCc1cccc(NC(N)=O)c1 |
| InChI | InChI=1S/C9H12N2O.C7H17N/c1-2-7-4-3-5-8(6-7)11-9(10)12;1-3-5-7-8-6-4-2/h3-6H,2H2,1H3,(H3,10,11,12);8H,3-7H2,1-2H3 |
| InChIKey | ZEIPYNHWCMBSFP-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.43 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|