About tert-butyl acetate;4-methyl-2-(propoxymethyl)hex-1-ene
tert-butyl acetate;4-methyl-2-(propoxymethyl)hex-1-ene (PubChem CID 144890740) has the molecular formula C17H34O3
and a molecular weight of 286.46 g/mol. Its IUPAC name is tert-butyl acetate;4-methyl-2-(propoxymethyl)hex-1-ene.
Molecular Properties
| Compound Name | tert-butyl acetate;4-methyl-2-(propoxymethyl)hex-1-ene |
| PubChem CID | 144890740 |
| Molecular Formula | C17H34O3 |
| Molecular Weight | 286.46 g/mol |
| Exact Mass | 286.25 |
| IUPAC Name | tert-butyl acetate;4-methyl-2-(propoxymethyl)hex-1-ene |
| SMILES | C=C(COCCC)CC(C)CC.CC(=O)OC(C)(C)C |
| InChI | InChI=1S/C11H22O.C6H12O2/c1-5-7-12-9-11(4)8-10(3)6-2;1-5(7)8-6(2,3)4/h10H,4-9H2,1-3H3;1-4H3 |
| InChIKey | XJCITHSEUYAMFR-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.46 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl acetate;4-methyl-2-(propoxymethyl)hex-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl acetate;4-methyl-2-(propoxymethyl)hex-1-ene?
The IUPAC name of tert-butyl acetate;4-methyl-2-(propoxymethyl)hex-1-ene (CID 144890740) is tert-butyl acetate;4-methyl-2-(propoxymethyl)hex-1-ene.
What is the SMILES notation for tert-butyl acetate;4-methyl-2-(propoxymethyl)hex-1-ene?
The canonical SMILES for tert-butyl acetate;4-methyl-2-(propoxymethyl)hex-1-ene is C=C(COCCC)CC(C)CC.CC(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl acetate;4-methyl-2-(propoxymethyl)hex-1-ene?
The InChIKey is XJCITHSEUYAMFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22O.C6H12O2/c1-5-7-12-9-11(4)8-10(3)6-2;1-5(7)8-6(2,3)4/h10H,4-9H2,1-3H3;1-4H3.
What are the key properties of tert-butyl acetate;4-methyl-2-(propoxymethyl)hex-1-ene?
tert-butyl acetate;4-methyl-2-(propoxymethyl)hex-1-ene has a molecular weight of 286.46 g/mol, XLogP of 4.75, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl acetate;4-methyl-2-(propoxymethyl)hex-1-ene is sourced from PubChem (CID 144890740), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).