C14H13F2N3S — CID 144891541
2-amino-5-(3,5-difluorophenyl)sulfanyl-N'-methylbenzenecarboximidamide (PubChem CID 144891541) has the molecular formula C14H13F2N3S and a molecular weight of 293.34 g/mol. Its IUPAC name is 2-amino-5-(3,5-difluorophenyl)sulfanyl-N'-methylbenzenecarboximidamide.
| Compound Name | 2-amino-5-(3,5-difluorophenyl)sulfanyl-N'-methylbenzenecarboximidamide |
|---|---|
| PubChem CID | 144891541 |
| Molecular Formula | C14H13F2N3S |
| Molecular Weight | 293.34 g/mol |
| Exact Mass | 293.08 |
| IUPAC Name | 2-amino-5-(3,5-difluorophenyl)sulfanyl-N'-methylbenzenecarboximidamide |
| SMILES | C/N=C(\N)c1cc(Sc2cc(F)cc(F)c2)ccc1N |
| InChI | InChI=1S/C14H13F2N3S/c1-19-14(18)12-7-10(2-3-13(12)17)20-11-5-8(15)4-9(16)6-11/h2-7H,17H2,1H3,(H2,18,19) |
| InChIKey | LLZDFEIIQGGFDL-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.34 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|