C15H14BrF2N3 — CID 145101640
2-amino-4-bromo-5-[(3,5-difluorophenyl)methyl]-N'-methylbenzenecarboximidamide (PubChem CID 145101640) has the molecular formula C15H14BrF2N3 and a molecular weight of 354.20 g/mol. Its IUPAC name is 2-amino-4-bromo-5-[(3,5-difluorophenyl)methyl]-N'-methylbenzenecarboximidamide.
| Compound Name | 2-amino-4-bromo-5-[(3,5-difluorophenyl)methyl]-N'-methylbenzenecarboximidamide |
|---|---|
| PubChem CID | 145101640 |
| Molecular Formula | C15H14BrF2N3 |
| Molecular Weight | 354.20 g/mol |
| Exact Mass | 353.03 |
| IUPAC Name | 2-amino-4-bromo-5-[(3,5-difluorophenyl)methyl]-N'-methylbenzenecarboximidamide |
| SMILES | C/N=C(\N)c1cc(Cc2cc(F)cc(F)c2)c(Br)cc1N |
| InChI | InChI=1S/C15H14BrF2N3/c1-21-15(20)12-5-9(13(16)7-14(12)19)2-8-3-10(17)6-11(18)4-8/h3-7H,2,19H2,1H3,(H2,20,21) |
| InChIKey | YXKSMGULWQFSLA-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.20 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|