C11H12F2N2 — CID 142149083
(1E,3Z)-5-(3,5-difluorophenyl)penta-1,3-diene-1,2-diamine (PubChem CID 142149083) has the molecular formula C11H12F2N2 and a molecular weight of 210.23 g/mol. Its IUPAC name is (1E,3Z)-5-(3,5-difluorophenyl)penta-1,3-diene-1,2-diamine.
| Compound Name | (1E,3Z)-5-(3,5-difluorophenyl)penta-1,3-diene-1,2-diamine |
|---|---|
| PubChem CID | 142149083 |
| Molecular Formula | C11H12F2N2 |
| Molecular Weight | 210.23 g/mol |
| Exact Mass | 210.10 |
| IUPAC Name | (1E,3Z)-5-(3,5-difluorophenyl)penta-1,3-diene-1,2-diamine |
| SMILES | N/C=C(N)\C=C/Cc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C11H12F2N2/c12-9-4-8(5-10(13)6-9)2-1-3-11(15)7-14/h1,3-7H,2,14-15H2/b3-1-,11-7+ |
| InChIKey | KCVXVZVDJMVECJ-XWOCEKJHSA-N |
| XLogP | 1.82 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.23 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|