C17H20N2O — CID 144892239
(3Z,5Z)-N-[cyclopropylidene(3,4-dihydropyridin-6-yl)methyl]-2-methylidenehepta-3,5-dienamide (PubChem CID 144892239) has the molecular formula C17H20N2O and a molecular weight of 268.36 g/mol. Its IUPAC name is (3Z,5Z)-N-[cyclopropylidene(3,4-dihydropyridin-6-yl)methyl]-2-methylidenehepta-3,5-dienamide.
| Compound Name | (3Z,5Z)-N-[cyclopropylidene(3,4-dihydropyridin-6-yl)methyl]-2-methylidenehepta-3,5-dienamide |
|---|---|
| PubChem CID | 144892239 |
| Molecular Formula | C17H20N2O |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.16 |
| IUPAC Name | (3Z,5Z)-N-[cyclopropylidene(3,4-dihydropyridin-6-yl)methyl]-2-methylidenehepta-3,5-dienamide |
| SMILES | C=C(/C=C\C=C/C)C(=O)NC(C1=CCCC=N1)=C1CC1 |
| InChI | InChI=1S/C17H20N2O/c1-3-4-5-8-13(2)17(20)19-16(14-10-11-14)15-9-6-7-12-18-15/h3-5,8-9,12H,2,6-7,10-11H2,1H3,(H,19,20)/b4-3-,8-5- |
| InChIKey | STVVISPSSSTOLL-UBNNFMAXSA-N |
| XLogP | 3.59 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|