About 3-[4-(aminomethyl)phenyl]-6-bromo-2-(2H-tetrazol-5-yl)benzenesulfonamide;ethane
3-[4-(aminomethyl)phenyl]-6-bromo-2-(2H-tetrazol-5-yl)benzenesulfonamide;ethane (PubChem CID 144893208) has the molecular formula C16H19BrN6O2S
and a molecular weight of 439.34 g/mol. Its IUPAC name is 3-[4-(aminomethyl)phenyl]-6-bromo-2-(2H-tetrazol-5-yl)benzenesulfonamide;ethane.
Molecular Properties
| Compound Name | 3-[4-(aminomethyl)phenyl]-6-bromo-2-(2H-tetrazol-5-yl)benzenesulfonamide;ethane |
| PubChem CID | 144893208 |
| Molecular Formula | C16H19BrN6O2S |
| Molecular Weight | 439.34 g/mol |
| Exact Mass | 438.05 |
| IUPAC Name | 3-[4-(aminomethyl)phenyl]-6-bromo-2-(2H-tetrazol-5-yl)benzenesulfonamide;ethane |
| SMILES | CC.NCc1ccc(-c2ccc(Br)c(S(N)(=O)=O)c2-c2nn[nH]n2)cc1 |
| InChI | InChI=1S/C14H13BrN6O2S.C2H6/c15-11-6-5-10(9-3-1-8(7-16)2-4-9)12(13(11)24(17,22)23)14-18-20-21-19-14;1-2/h1-6H,7,16H2,(H2,17,22,23)(H,18,19,20,21);1-2H3 |
| InChIKey | MITOBGCIXHRTIP-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 140.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 439.34 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-[4-(aminomethyl)phenyl]-6-bromo-2-(2H-tetrazol-5-yl)benzenesulfonamide;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-(aminomethyl)phenyl]-6-bromo-2-(2H-tetrazol-5-yl)benzenesulfonamide;ethane?
The IUPAC name of 3-[4-(aminomethyl)phenyl]-6-bromo-2-(2H-tetrazol-5-yl)benzenesulfonamide;ethane (CID 144893208) is 3-[4-(aminomethyl)phenyl]-6-bromo-2-(2H-tetrazol-5-yl)benzenesulfonamide;ethane.
What is the SMILES notation for 3-[4-(aminomethyl)phenyl]-6-bromo-2-(2H-tetrazol-5-yl)benzenesulfonamide;ethane?
The canonical SMILES for 3-[4-(aminomethyl)phenyl]-6-bromo-2-(2H-tetrazol-5-yl)benzenesulfonamide;ethane is CC.NCc1ccc(-c2ccc(Br)c(S(N)(=O)=O)c2-c2nn[nH]n2)cc1.
What is the InChIKey of 3-[4-(aminomethyl)phenyl]-6-bromo-2-(2H-tetrazol-5-yl)benzenesulfonamide;ethane?
The InChIKey is MITOBGCIXHRTIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13BrN6O2S.C2H6/c15-11-6-5-10(9-3-1-8(7-16)2-4-9)12(13(11)24(17,22)23)14-18-20-21-19-14;1-2/h1-6H,7,16H2,(H2,17,22,23)(H,18,19,20,21);1-2H3.
What are the key properties of 3-[4-(aminomethyl)phenyl]-6-bromo-2-(2H-tetrazol-5-yl)benzenesulfonamide;ethane?
3-[4-(aminomethyl)phenyl]-6-bromo-2-(2H-tetrazol-5-yl)benzenesulfonamide;ethane has a molecular weight of 439.34 g/mol, XLogP of 2.43, 4 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-(aminomethyl)phenyl]-6-bromo-2-(2H-tetrazol-5-yl)benzenesulfonamide;ethane is sourced from PubChem (CID 144893208), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).