C16H22 — CID 144899057
(2Z)-2-ethylidene-1-(2-methylbutan-2-yl)-1,3-dihydroindene (PubChem CID 144899057) has the molecular formula C16H22 and a molecular weight of 214.35 g/mol. Its IUPAC name is (2Z)-2-ethylidene-1-(2-methylbutan-2-yl)-1,3-dihydroindene.
| Compound Name | (2Z)-2-ethylidene-1-(2-methylbutan-2-yl)-1,3-dihydroindene |
|---|---|
| PubChem CID | 144899057 |
| Molecular Formula | C16H22 |
| Molecular Weight | 214.35 g/mol |
| Exact Mass | 214.17 |
| IUPAC Name | (2Z)-2-ethylidene-1-(2-methylbutan-2-yl)-1,3-dihydroindene |
| SMILES | C/C=C1/Cc2ccccc2C1C(C)(C)CC |
| InChI | InChI=1S/C16H22/c1-5-12-11-13-9-7-8-10-14(13)15(12)16(3,4)6-2/h5,7-10,15H,6,11H2,1-4H3/b12-5- |
| InChIKey | YWWVVRJLOUANBH-XGICHPGQSA-N |
| XLogP | 4.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.35 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|