C25H35N7O4 — CID 144902316
4-amino-N-[3-(diethylamino)propyl]benzamide;2-amino-3-oxo-N-(2-oxo-1,3-dihydrobenzimidazol-5-yl)butanamide (PubChem CID 144902316) has the molecular formula C25H35N7O4 and a molecular weight of 497.60 g/mol. Its IUPAC name is 4-amino-N-[3-(diethylamino)propyl]benzamide;2-amino-3-oxo-N-(2-oxo-1,3-dihydrobenzimidazol-5-yl)butanamide.
| Compound Name | 4-amino-N-[3-(diethylamino)propyl]benzamide;2-amino-3-oxo-N-(2-oxo-1,3-dihydrobenzimidazol-5-yl)butanamide |
|---|---|
| PubChem CID | 144902316 |
| Molecular Formula | C25H35N7O4 |
| Molecular Weight | 497.60 g/mol |
| Exact Mass | 497.28 |
| IUPAC Name | 4-amino-N-[3-(diethylamino)propyl]benzamide;2-amino-3-oxo-N-(2-oxo-1,3-dihydrobenzimidazol-5-yl)butanamide |
| SMILES | CC(=O)C(N)C(=O)Nc1ccc2[nH]c(=O)[nH]c2c1.CCN(CC)CCCNC(=O)c1ccc(N)cc1 |
| InChI | InChI=1S/C14H23N3O.C11H12N4O3/c1-3-17(4-2)11-5-10-16-14(18)12-6-8-13(15)9-7-12;1-5(16)9(12)10(17)13-6-2-3-7-8(4-6)15-11(18)14-7/h6-9H,3-5,10-11,15H2,1-2H3,(H,16,18);2-4,9H,12H2,1H3,(H,13,17)(H2,14,15,18) |
| InChIKey | CTBFOHZSMKAINE-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 179.20 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.60 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|