C34H51N11O5 — CID 144680768
2-amino-3-oxo-N-(2-oxo-1,3-dihydrobenzimidazol-5-yl)butanamide;4-N-[4,6-bis[3-(diethylamino)propoxy]-1,3,5-triazin-2-yl]benzene-1,4-diamine (PubChem CID 144680768) has the molecular formula C34H51N11O5 and a molecular weight of 693.85 g/mol. Its IUPAC name is 2-amino-3-oxo-N-(2-oxo-1,3-dihydrobenzimidazol-5-yl)butanamide;4-N-[4,6-bis[3-(diethylamino)propoxy]-1,3,5-triazin-2-yl]benzene-1,4-diamine.
| Compound Name | 2-amino-3-oxo-N-(2-oxo-1,3-dihydrobenzimidazol-5-yl)butanamide;4-N-[4,6-bis[3-(diethylamino)propoxy]-1,3,5-triazin-2-yl]benzene-1,4-diamine |
|---|---|
| PubChem CID | 144680768 |
| Molecular Formula | C34H51N11O5 |
| Molecular Weight | 693.85 g/mol |
| Exact Mass | 693.41 |
| IUPAC Name | 2-amino-3-oxo-N-(2-oxo-1,3-dihydrobenzimidazol-5-yl)butanamide;4-N-[4,6-bis[3-(diethylamino)propoxy]-1,3,5-triazin-2-yl]benzene-1,4-diamine |
| SMILES | CC(=O)C(N)C(=O)Nc1ccc2[nH]c(=O)[nH]c2c1.CCN(CC)CCCOc1nc(Nc2ccc(N)cc2)nc(OCCCN(CC)CC)n1 |
| InChI | InChI=1S/C23H39N7O2.C11H12N4O3/c1-5-29(6-2)15-9-17-31-22-26-21(25-20-13-11-19(24)12-14-20)27-23(28-22)32-18-10-16-30(7-3)8-4;1-5(16)9(12)10(17)13-6-2-3-7-8(4-6)15-11(18)14-7/h11-14H,5-10,15-18,24H2,1-4H3,(H,25,26,27,28);2-4,9H,12H2,1H3,(H,13,17)(H2,14,15,18) |
| InChIKey | HXGRGGDRYJSAHB-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 222.50 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.85 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|