C24H29N7O3 — CID 144903259
6-[4-(4-acetylpiperazine-1-carbonyl)anilino]-4-[[(E)-2-ethenylbut-2-enyl]amino]pyridazine-3-carboxamide (PubChem CID 144903259) has the molecular formula C24H29N7O3 and a molecular weight of 463.54 g/mol. Its IUPAC name is 6-[4-(4-acetylpiperazine-1-carbonyl)anilino]-4-[[(E)-2-ethenylbut-2-enyl]amino]pyridazine-3-carboxamide.
| Compound Name | 6-[4-(4-acetylpiperazine-1-carbonyl)anilino]-4-[[(E)-2-ethenylbut-2-enyl]amino]pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 144903259 |
| Molecular Formula | C24H29N7O3 |
| Molecular Weight | 463.54 g/mol |
| Exact Mass | 463.23 |
| IUPAC Name | 6-[4-(4-acetylpiperazine-1-carbonyl)anilino]-4-[[(E)-2-ethenylbut-2-enyl]amino]pyridazine-3-carboxamide |
| SMILES | C=C/C(=C\C)CNc1cc(Nc2ccc(C(=O)N3CCN(C(C)=O)CC3)cc2)nnc1C(N)=O |
| InChI | InChI=1S/C24H29N7O3/c1-4-17(5-2)15-26-20-14-21(28-29-22(20)23(25)33)27-19-8-6-18(7-9-19)24(34)31-12-10-30(11-13-31)16(3)32/h4-9,14H,1,10-13,15H2,2-3H3,(H2,25,33)(H2,26,27,28)/b17-5+ |
| InChIKey | YGCGJILFLZIZBE-YAXRCOADSA-N |
| XLogP | 2.17 |
| TPSA | 133.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.54 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|