C22H23FN6O3S — CID 118320668
6-[4-(1,1-dioxo-1,4-thiazinan-4-yl)anilino]-4-[(3-fluorophenyl)methylamino]pyridazine-3-carboxamide (PubChem CID 118320668) has the molecular formula C22H23FN6O3S and a molecular weight of 470.53 g/mol. Its IUPAC name is 6-[4-(1,1-dioxo-1,4-thiazinan-4-yl)anilino]-4-[(3-fluorophenyl)methylamino]pyridazine-3-carboxamide.
| Compound Name | 6-[4-(1,1-dioxo-1,4-thiazinan-4-yl)anilino]-4-[(3-fluorophenyl)methylamino]pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 118320668 |
| Molecular Formula | C22H23FN6O3S |
| Molecular Weight | 470.53 g/mol |
| Exact Mass | 470.15 |
| IUPAC Name | 6-[4-(1,1-dioxo-1,4-thiazinan-4-yl)anilino]-4-[(3-fluorophenyl)methylamino]pyridazine-3-carboxamide |
| SMILES | NC(=O)c1nnc(Nc2ccc(N3CCS(=O)(=O)CC3)cc2)cc1NCc1cccc(F)c1 |
| InChI | InChI=1S/C22H23FN6O3S/c23-16-3-1-2-15(12-16)14-25-19-13-20(27-28-21(19)22(24)30)26-17-4-6-18(7-5-17)29-8-10-33(31,32)11-9-29/h1-7,12-13H,8-11,14H2,(H2,24,30)(H2,25,26,27) |
| InChIKey | SQYJSBPPJPQADE-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 130.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.53 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|