C23H23F2N5O2 — CID 129266265
1-[4-[(2,3-difluorophenyl)methylamino]-6-(4-morpholin-4-ylanilino)pyridazin-3-yl]ethanone (PubChem CID 129266265) has the molecular formula C23H23F2N5O2 and a molecular weight of 439.47 g/mol. Its IUPAC name is 1-[4-[(2,3-difluorophenyl)methylamino]-6-(4-morpholin-4-ylanilino)pyridazin-3-yl]ethanone.
| Compound Name | 1-[4-[(2,3-difluorophenyl)methylamino]-6-(4-morpholin-4-ylanilino)pyridazin-3-yl]ethanone |
|---|---|
| PubChem CID | 129266265 |
| Molecular Formula | C23H23F2N5O2 |
| Molecular Weight | 439.47 g/mol |
| Exact Mass | 439.18 |
| IUPAC Name | 1-[4-[(2,3-difluorophenyl)methylamino]-6-(4-morpholin-4-ylanilino)pyridazin-3-yl]ethanone |
| SMILES | CC(=O)c1nnc(Nc2ccc(N3CCOCC3)cc2)cc1NCc1cccc(F)c1F |
| InChI | InChI=1S/C23H23F2N5O2/c1-15(31)23-20(26-14-16-3-2-4-19(24)22(16)25)13-21(28-29-23)27-17-5-7-18(8-6-17)30-9-11-32-12-10-30/h2-8,13H,9-12,14H2,1H3,(H2,26,27,28) |
| InChIKey | HNDPRAZEGGGOKI-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.47 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|