C26H25F2N7O2 — CID 67423885
6-[4-[4-(2-cyanoacetyl)piperazin-1-yl]anilino]-4-[(2,3-difluorophenyl)methylamino]pyridine-3-carboxamide (PubChem CID 67423885) has the molecular formula C26H25F2N7O2 and a molecular weight of 505.53 g/mol. Its IUPAC name is 6-[4-[4-(2-cyanoacetyl)piperazin-1-yl]anilino]-4-[(2,3-difluorophenyl)methylamino]pyridine-3-carboxamide.
| Compound Name | 6-[4-[4-(2-cyanoacetyl)piperazin-1-yl]anilino]-4-[(2,3-difluorophenyl)methylamino]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 67423885 |
| Molecular Formula | C26H25F2N7O2 |
| Molecular Weight | 505.53 g/mol |
| Exact Mass | 505.20 |
| IUPAC Name | 6-[4-[4-(2-cyanoacetyl)piperazin-1-yl]anilino]-4-[(2,3-difluorophenyl)methylamino]pyridine-3-carboxamide |
| SMILES | N#CCC(=O)N1CCN(c2ccc(Nc3cc(NCc4cccc(F)c4F)c(C(N)=O)cn3)cc2)CC1 |
| InChI | InChI=1S/C26H25F2N7O2/c27-21-3-1-2-17(25(21)28)15-31-22-14-23(32-16-20(22)26(30)37)33-18-4-6-19(7-5-18)34-10-12-35(13-11-34)24(36)8-9-29/h1-7,14,16H,8,10-13,15H2,(H2,30,37)(H2,31,32,33) |
| InChIKey | ZEJYONNIMDSPSH-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 127.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.53 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|