C24H30FN7O2 — CID 118320659
4-[[(Z)-2-ethenyl-3-fluorobut-2-enyl]amino]-6-[4-(4-propanoylpiperazin-1-yl)anilino]pyridazine-3-carboxamide (PubChem CID 118320659) has the molecular formula C24H30FN7O2 and a molecular weight of 467.55 g/mol. Its IUPAC name is 4-[[(Z)-2-ethenyl-3-fluorobut-2-enyl]amino]-6-[4-(4-propanoylpiperazin-1-yl)anilino]pyridazine-3-carboxamide.
| Compound Name | 4-[[(Z)-2-ethenyl-3-fluorobut-2-enyl]amino]-6-[4-(4-propanoylpiperazin-1-yl)anilino]pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 118320659 |
| Molecular Formula | C24H30FN7O2 |
| Molecular Weight | 467.55 g/mol |
| Exact Mass | 467.24 |
| IUPAC Name | 4-[[(Z)-2-ethenyl-3-fluorobut-2-enyl]amino]-6-[4-(4-propanoylpiperazin-1-yl)anilino]pyridazine-3-carboxamide |
| SMILES | C=C/C(CNc1cc(Nc2ccc(N3CCN(C(=O)CC)CC3)cc2)nnc1C(N)=O)=C(\C)F |
| InChI | InChI=1S/C24H30FN7O2/c1-4-17(16(3)25)15-27-20-14-21(29-30-23(20)24(26)34)28-18-6-8-19(9-7-18)31-10-12-32(13-11-31)22(33)5-2/h4,6-9,14H,1,5,10-13,15H2,2-3H3,(H2,26,34)(H2,27,28,29)/b17-16- |
| InChIKey | XZGNOXDNTDRTDK-MSUUIHNZSA-N |
| XLogP | 3.22 |
| TPSA | 116.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.55 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|