C20H30ClN3O3 — CID 144906134
4-[(5-chloro-2-ethoxyphenyl)methylamino]-3,3-dimethyl-N-[(E)-3-(methylamino)-1-oxobut-2-en-2-yl]butanamide (PubChem CID 144906134) has the molecular formula C20H30ClN3O3 and a molecular weight of 395.93 g/mol. Its IUPAC name is 4-[(5-chloro-2-ethoxyphenyl)methylamino]-3,3-dimethyl-N-[(E)-3-(methylamino)-1-oxobut-2-en-2-yl]butanamide.
| Compound Name | 4-[(5-chloro-2-ethoxyphenyl)methylamino]-3,3-dimethyl-N-[(E)-3-(methylamino)-1-oxobut-2-en-2-yl]butanamide |
|---|---|
| PubChem CID | 144906134 |
| Molecular Formula | C20H30ClN3O3 |
| Molecular Weight | 395.93 g/mol |
| Exact Mass | 395.20 |
| IUPAC Name | 4-[(5-chloro-2-ethoxyphenyl)methylamino]-3,3-dimethyl-N-[(E)-3-(methylamino)-1-oxobut-2-en-2-yl]butanamide |
| SMILES | CCOc1ccc(Cl)cc1CNCC(C)(C)CC(=O)N/C(C=O)=C(\C)NC |
| InChI | InChI=1S/C20H30ClN3O3/c1-6-27-18-8-7-16(21)9-15(18)11-23-13-20(3,4)10-19(26)24-17(12-25)14(2)22-5/h7-9,12,22-23H,6,10-11,13H2,1-5H3,(H,24,26)/b17-14+ |
| InChIKey | YISXWPWBXLGSIZ-SAPNQHFASA-N |
| XLogP | 3.01 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.93 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|