C30H45ClN4O3 — CID 144906151
4-[(5-chloro-2-ethoxyphenyl)methylamino]-3,3-dimethyl-N-[(E)-4-methyl-3-(methylamino)-1-oxohex-2-en-2-yl]butanamide;N-methylaniline (PubChem CID 144906151) has the molecular formula C30H45ClN4O3 and a molecular weight of 545.17 g/mol. Its IUPAC name is 4-[(5-chloro-2-ethoxyphenyl)methylamino]-3,3-dimethyl-N-[(E)-4-methyl-3-(methylamino)-1-oxohex-2-en-2-yl]butanamide;N-methylaniline.
| Compound Name | 4-[(5-chloro-2-ethoxyphenyl)methylamino]-3,3-dimethyl-N-[(E)-4-methyl-3-(methylamino)-1-oxohex-2-en-2-yl]butanamide;N-methylaniline |
|---|---|
| PubChem CID | 144906151 |
| Molecular Formula | C30H45ClN4O3 |
| Molecular Weight | 545.17 g/mol |
| Exact Mass | 544.32 |
| IUPAC Name | 4-[(5-chloro-2-ethoxyphenyl)methylamino]-3,3-dimethyl-N-[(E)-4-methyl-3-(methylamino)-1-oxohex-2-en-2-yl]butanamide;N-methylaniline |
| SMILES | CCOc1ccc(Cl)cc1CNCC(C)(C)CC(=O)N/C(C=O)=C(/NC)C(C)CC.CNc1ccccc1 |
| InChI | InChI=1S/C23H36ClN3O3.C7H9N/c1-7-16(3)22(25-6)19(14-28)27-21(29)12-23(4,5)15-26-13-17-11-18(24)9-10-20(17)30-8-2;1-8-7-5-3-2-4-6-7/h9-11,14,16,25-26H,7-8,12-13,15H2,1-6H3,(H,27,29);2-6,8H,1H3/b22-19+; |
| InChIKey | LQKFLTGLIRLFLU-KWNKHXGFSA-N |
| XLogP | 5.77 |
| TPSA | 91.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.17 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|