C34H48ClN5O5 — CID 144905880
[3-[[(E)-4-(hydroxymethyl)-3-(methylamino)-1-oxohept-2-en-2-yl]carbamoyl]cyclohexyl]methyl (1Z)-5-chloro-2-ethoxy-N-methylidenebenzenecarbohydrazonate;N-methylaniline (PubChem CID 144905880) has the molecular formula C34H48ClN5O5 and a molecular weight of 642.24 g/mol. Its IUPAC name is [3-[[(E)-4-(hydroxymethyl)-3-(methylamino)-1-oxohept-2-en-2-yl]carbamoyl]cyclohexyl]methyl (1Z)-5-chloro-2-ethoxy-N-methylidenebenzenecarbohydrazonate;N-methylaniline.
| Compound Name | [3-[[(E)-4-(hydroxymethyl)-3-(methylamino)-1-oxohept-2-en-2-yl]carbamoyl]cyclohexyl]methyl (1Z)-5-chloro-2-ethoxy-N-methylidenebenzenecarbohydrazonate;N-methylaniline |
|---|---|
| PubChem CID | 144905880 |
| Molecular Formula | C34H48ClN5O5 |
| Molecular Weight | 642.24 g/mol |
| Exact Mass | 641.33 |
| IUPAC Name | [3-[[(E)-4-(hydroxymethyl)-3-(methylamino)-1-oxohept-2-en-2-yl]carbamoyl]cyclohexyl]methyl (1Z)-5-chloro-2-ethoxy-N-methylidenebenzenecarbohydrazonate;N-methylaniline |
| SMILES | C=N/N=C(\OCC1CCCC(C(=O)N/C(C=O)=C(/NC)C(CO)CCC)C1)c1cc(Cl)ccc1OCC.CNc1ccccc1 |
| InChI | InChI=1S/C27H39ClN4O5.C7H9N/c1-5-8-20(15-33)25(29-3)23(16-34)31-26(35)19-10-7-9-18(13-19)17-37-27(32-30-4)22-14-21(28)11-12-24(22)36-6-2;1-8-7-5-3-2-4-6-7/h11-12,14,16,18-20,29,33H,4-10,13,15,17H2,1-3H3,(H,31,35);2-6,8H,1H3/b25-23+,32-27-; |
| InChIKey | BDILIWUJFZCDNK-CVNGYFNDSA-N |
| XLogP | 5.81 |
| TPSA | 133.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.24 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|