C19H26ClNO3 — CID 144906242
(Z)-2-[3-(5-chloro-2-ethoxyphenyl)-2,2-dimethylpropyl]-3-(methylamino)pent-2-enedial (PubChem CID 144906242) has the molecular formula C19H26ClNO3 and a molecular weight of 351.87 g/mol. Its IUPAC name is (Z)-2-[3-(5-chloro-2-ethoxyphenyl)-2,2-dimethylpropyl]-3-(methylamino)pent-2-enedial.
| Compound Name | (Z)-2-[3-(5-chloro-2-ethoxyphenyl)-2,2-dimethylpropyl]-3-(methylamino)pent-2-enedial |
|---|---|
| PubChem CID | 144906242 |
| Molecular Formula | C19H26ClNO3 |
| Molecular Weight | 351.87 g/mol |
| Exact Mass | 351.16 |
| IUPAC Name | (Z)-2-[3-(5-chloro-2-ethoxyphenyl)-2,2-dimethylpropyl]-3-(methylamino)pent-2-enedial |
| SMILES | CCOc1ccc(Cl)cc1CC(C)(C)C/C(C=O)=C(\CC=O)NC |
| InChI | InChI=1S/C19H26ClNO3/c1-5-24-18-7-6-16(20)10-14(18)11-19(2,3)12-15(13-23)17(21-4)8-9-22/h6-7,9-10,13,21H,5,8,11-12H2,1-4H3/b17-15- |
| InChIKey | APLVYESDMSGEIH-ICFOKQHNSA-N |
| XLogP | 3.96 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.87 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|